About 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate
2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate (PubChem CID 174167216) has the molecular formula C17H35NO3Si
and a molecular weight of 329.56 g/mol. Its IUPAC name is 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate |
| PubChem CID | 174167216 |
| Molecular Formula | C17H35NO3Si |
| Molecular Weight | 329.56 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate |
| SMILES | CCCN(CCC)[C@@H](CCC(=O)OCC[Si](C)(C)C)C(C)=O |
| InChI | InChI=1S/C17H35NO3Si/c1-7-11-18(12-8-2)16(15(3)19)9-10-17(20)21-13-14-22(4,5)6/h16H,7-14H2,1-6H3/t16-/m0/s1 |
| InChIKey | QXMDDGDHPLBINL-INIZCTEOSA-N |
| XLogP | 3.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate?
The IUPAC name of 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate (CID 174167216) is 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate.
What is the SMILES notation for 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate?
The canonical SMILES for 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate is CCCN(CCC)[C@@H](CCC(=O)OCC[Si](C)(C)C)C(C)=O.
What is the InChIKey of 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate?
The InChIKey is QXMDDGDHPLBINL-INIZCTEOSA-N. The full InChI is InChI=1S/C17H35NO3Si/c1-7-11-18(12-8-2)16(15(3)19)9-10-17(20)21-13-14-22(4,5)6/h16H,7-14H2,1-6H3/t16-/m0/s1.
What are the key properties of 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate?
2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate has a molecular weight of 329.56 g/mol, XLogP of 3.73, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl (4S)-4-(dipropylamino)-5-oxohexanoate is sourced from PubChem (CID 174167216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).