C11H22O4Si — CID 86665259
(3S)-3-methyl-5-oxo-5-(2-trimethylsilylethoxy)pentanoic acid (PubChem CID 86665259) has the molecular formula C11H22O4Si and a molecular weight of 246.38 g/mol. Its IUPAC name is (3S)-3-methyl-5-oxo-5-(2-trimethylsilylethoxy)pentanoic acid.
| Compound Name | (3S)-3-methyl-5-oxo-5-(2-trimethylsilylethoxy)pentanoic acid |
|---|---|
| PubChem CID | 86665259 |
| Molecular Formula | C11H22O4Si |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (3S)-3-methyl-5-oxo-5-(2-trimethylsilylethoxy)pentanoic acid |
| SMILES | C[C@@H](CC(=O)O)CC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C11H22O4Si/c1-9(7-10(12)13)8-11(14)15-5-6-16(2,3)4/h9H,5-8H2,1-4H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | KTGURSUTLZFGBH-VIFPVBQESA-N |
| XLogP | 2.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|