C16H29N3O7Si — CID 175361596
4-amino-4-oxo-3-[2-[[4-oxo-4-(2-trimethylsilylethoxy)butanoyl]amino]propanoylamino]butanoic acid (PubChem CID 175361596) has the molecular formula C16H29N3O7Si and a molecular weight of 403.51 g/mol. Its IUPAC name is 4-amino-4-oxo-3-[2-[[4-oxo-4-(2-trimethylsilylethoxy)butanoyl]amino]propanoylamino]butanoic acid.
| Compound Name | 4-amino-4-oxo-3-[2-[[4-oxo-4-(2-trimethylsilylethoxy)butanoyl]amino]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 175361596 |
| Molecular Formula | C16H29N3O7Si |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 4-amino-4-oxo-3-[2-[[4-oxo-4-(2-trimethylsilylethoxy)butanoyl]amino]propanoylamino]butanoic acid |
| SMILES | CC(NC(=O)CCC(=O)OCC[Si](C)(C)C)C(=O)NC(CC(=O)O)C(N)=O |
| InChI | InChI=1S/C16H29N3O7Si/c1-10(16(25)19-11(15(17)24)9-13(21)22)18-12(20)5-6-14(23)26-7-8-27(2,3)4/h10-11H,5-9H2,1-4H3,(H2,17,24)(H,18,20)(H,19,25)(H,21,22) |
| InChIKey | KIGFAJCGGKATBV-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|