C12H21N3O5S — CID 46882770
(3S)-4-amino-3-[[(2S)-4-methyl-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-4-oxobutanoic acid (PubChem CID 46882770) has the molecular formula C12H21N3O5S and a molecular weight of 319.38 g/mol. Its IUPAC name is (3S)-4-amino-3-[[(2S)-4-methyl-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-amino-3-[[(2S)-4-methyl-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 46882770 |
| Molecular Formula | C12H21N3O5S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (3S)-4-amino-3-[[(2S)-4-methyl-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CS)C(=O)N[C@@H](CC(=O)O)C(N)=O |
| InChI | InChI=1S/C12H21N3O5S/c1-6(2)3-8(14-9(16)5-21)12(20)15-7(11(13)19)4-10(17)18/h6-8,21H,3-5H2,1-2H3,(H2,13,19)(H,14,16)(H,15,20)(H,17,18)/t7-,8-/m0/s1 |
| InChIKey | PGDGDEYKXGREOE-YUMQZZPRSA-N |
| XLogP | -1.11 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|