C14H28N6O3S — CID 46882494
(2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-4-methylpentanamide (PubChem CID 46882494) has the molecular formula C14H28N6O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 46882494 |
| Molecular Formula | C14H28N6O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (2S)-2-[[(2S)-5-(diaminomethylideneamino)-2-[(2-sulfanylacetyl)amino]pentanoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)CS)C(N)=O |
| InChI | InChI=1S/C14H28N6O3S/c1-8(2)6-10(12(15)22)20-13(23)9(19-11(21)7-24)4-3-5-18-14(16)17/h8-10,24H,3-7H2,1-2H3,(H2,15,22)(H,19,21)(H,20,23)(H4,16,17,18)/t9-,10-/m0/s1 |
| InChIKey | QKLCQMKMJCLLEG-UWVGGRQHSA-N |
| XLogP | -1.53 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|