C21H44N14O4S — CID 118900899
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 118900899) has the molecular formula C21H44N14O4S and a molecular weight of 588.74 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 118900899 |
| Molecular Formula | C21H44N14O4S |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.34 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCN=C(N)N)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CS |
| InChI | InChI=1S/C21H44N14O4S/c22-11(10-40)16(37)34-13(5-2-8-31-20(26)27)18(39)35-14(6-3-9-32-21(28)29)17(38)33-12(15(23)36)4-1-7-30-19(24)25/h11-14,40H,1-10,22H2,(H2,23,36)(H,33,38)(H,34,37)(H,35,39)(H4,24,25,30)(H4,26,27,31)(H4,28,29,32) |
| InChIKey | IDZBPGDEWPNNAH-UHFFFAOYSA-N |
| XLogP | -5.66 |
| TPSA | 349.61 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | -5.66 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|