C12H22N4O5S — CID 46882697
(3S)-4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid (PubChem CID 46882697) has the molecular formula C12H22N4O5S and a molecular weight of 334.40 g/mol. Its IUPAC name is (3S)-4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid.
| Compound Name | (3S)-4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid |
|---|---|
| PubChem CID | 46882697 |
| Molecular Formula | C12H22N4O5S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (3S)-4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-oxo-3-[(2-sulfanylacetyl)amino]butanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)CS)C(N)=O |
| InChI | InChI=1S/C12H22N4O5S/c13-4-2-1-3-7(11(14)20)16-12(21)8(5-10(18)19)15-9(17)6-22/h7-8,22H,1-6,13H2,(H2,14,20)(H,15,17)(H,16,21)(H,18,19)/t7-,8-/m0/s1 |
| InChIKey | QXJWJGNOGIFLND-YUMQZZPRSA-N |
| XLogP | -2.03 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|