C24H44N6O8 — CID 24850970
(3S)-4-[[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-oxobutanoic acid (PubChem CID 24850970) has the molecular formula C24H44N6O8 and a molecular weight of 544.65 g/mol. Its IUPAC name is (3S)-4-[[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 24850970 |
| Molecular Formula | C24H44N6O8 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | (3S)-4-[[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-3-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C24H44N6O8/c1-13(2)9-15(11-19(31)30-38)22(35)28-18(12-20(32)33)24(37)29-17(10-14(3)4)23(36)27-16(21(26)34)7-5-6-8-25/h13-18,38H,5-12,25H2,1-4H3,(H2,26,34)(H,27,36)(H,28,35)(H,29,37)(H,30,31)(H,32,33)/t15-,16+,17+,18+/m1/s1 |
| InChIKey | SQGMVKQQABZOCL-OWSLCNJRSA-N |
| XLogP | -0.87 |
| TPSA | 243.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|