C21H38N6O8 — CID 24851030
(3S)-4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-3-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]propanoyl]amino]-4-oxobutanoic acid (PubChem CID 24851030) has the molecular formula C21H38N6O8 and a molecular weight of 502.57 g/mol. Its IUPAC name is (3S)-4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-3-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]propanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-3-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]propanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 24851030 |
| Molecular Formula | C21H38N6O8 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | (3S)-4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-3-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]propanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C21H38N6O8/c1-11(2)8-13(9-16(28)27-35)20(33)24-12(3)19(32)26-15(10-17(29)30)21(34)25-14(18(23)31)6-4-5-7-22/h11-15,35H,4-10,22H2,1-3H3,(H2,23,31)(H,24,33)(H,25,34)(H,26,32)(H,27,28)(H,29,30)/t12-,13+,14-,15-/m0/s1 |
| InChIKey | DSANLTPINPZCQQ-XGUBFFRZSA-N |
| XLogP | -1.89 |
| TPSA | 243.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|