C25H46N6O6 — CID 24851027
(2R)-N-[(2S)-1-[(2S)-2-[[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide (PubChem CID 24851027) has the molecular formula C25H46N6O6 and a molecular weight of 526.68 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[(2S)-2-[[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide.
| Compound Name | (2R)-N-[(2S)-1-[(2S)-2-[[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 24851027 |
| Molecular Formula | C25H46N6O6 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | (2R)-N-[(2S)-1-[(2S)-2-[[(2S)-1,6-diamino-1-oxohexan-2-yl]carbamoyl]pyrrolidin-1-yl]-4-methyl-1-oxopentan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C25H46N6O6/c1-15(2)12-17(14-21(32)30-37)23(34)29-19(13-16(3)4)25(36)31-11-7-9-20(31)24(35)28-18(22(27)33)8-5-6-10-26/h15-20,37H,5-14,26H2,1-4H3,(H2,27,33)(H,28,35)(H,29,34)(H,30,32)/t17-,18+,19+,20+/m1/s1 |
| InChIKey | JJJJPZPWOSIDPU-FYQPLNBISA-N |
| XLogP | 0.17 |
| TPSA | 196.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|