C25H46N6O8 — CID 24850918
(4S)-5-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid (PubChem CID 24850918) has the molecular formula C25H46N6O8 and a molecular weight of 558.68 g/mol. Its IUPAC name is (4S)-5-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 24850918 |
| Molecular Formula | C25H46N6O8 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.34 |
| IUPAC Name | (4S)-5-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-4-[[(2S)-2-[[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C25H46N6O8/c1-14(2)11-16(13-20(32)31-39)23(36)30-19(12-15(3)4)25(38)29-18(8-9-21(33)34)24(37)28-17(22(27)35)7-5-6-10-26/h14-19,39H,5-13,26H2,1-4H3,(H2,27,35)(H,28,37)(H,29,38)(H,30,36)(H,31,32)(H,33,34)/t16-,17+,18+,19+/m1/s1 |
| InChIKey | MEMYFSVNOZMMPF-XWSJACJDSA-N |
| XLogP | -0.48 |
| TPSA | 243.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|