C19H33N3O6 — CID 10453547
(4R)-5-amino-5-oxo-4-[[(2S)-2-(7-oxoundecanoylamino)propanoyl]amino]pentanoic acid (PubChem CID 10453547) has the molecular formula C19H33N3O6 and a molecular weight of 399.49 g/mol. Its IUPAC name is (4R)-5-amino-5-oxo-4-[[(2S)-2-(7-oxoundecanoylamino)propanoyl]amino]pentanoic acid.
| Compound Name | (4R)-5-amino-5-oxo-4-[[(2S)-2-(7-oxoundecanoylamino)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10453547 |
| Molecular Formula | C19H33N3O6 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | (4R)-5-amino-5-oxo-4-[[(2S)-2-(7-oxoundecanoylamino)propanoyl]amino]pentanoic acid |
| SMILES | CCCCC(=O)CCCCCC(=O)N[C@@H](C)C(=O)N[C@H](CCC(=O)O)C(N)=O |
| InChI | InChI=1S/C19H33N3O6/c1-3-4-8-14(23)9-6-5-7-10-16(24)21-13(2)19(28)22-15(18(20)27)11-12-17(25)26/h13,15H,3-12H2,1-2H3,(H2,20,27)(H,21,24)(H,22,28)(H,25,26)/t13-,15+/m0/s1 |
| InChIKey | ZQZZXEVHDNGUSC-DZGCQCFKSA-N |
| XLogP | 1.04 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|