C21H41N3O7 — CID 157237897
bis(2-methylpropanamide);(2S)-2-(octanoylamino)pentanedioic acid (PubChem CID 157237897) has the molecular formula C21H41N3O7 and a molecular weight of 447.57 g/mol. Its IUPAC name is bis(2-methylpropanamide);(2S)-2-(octanoylamino)pentanedioic acid.
| Compound Name | bis(2-methylpropanamide);(2S)-2-(octanoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 157237897 |
| Molecular Formula | C21H41N3O7 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | bis(2-methylpropanamide);(2S)-2-(octanoylamino)pentanedioic acid |
| SMILES | CC(C)C(N)=O.CC(C)C(N)=O.CCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H23NO5.2C4H9NO/c1-2-3-4-5-6-7-11(15)14-10(13(18)19)8-9-12(16)17;2*1-3(2)4(5)6/h10H,2-9H2,1H3,(H,14,15)(H,16,17)(H,18,19);2*3H,1-2H3,(H2,5,6)/t10-;;/m0../s1 |
| InChIKey | AUVWKVJZXAXILK-XRIOVQLTSA-N |
| XLogP | 2.04 |
| TPSA | 189.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|