C10H21NO4Si — CID 156620019
(2S)-2-(2-trimethylsilylethoxycarbonylamino)butanoic acid (PubChem CID 156620019) has the molecular formula C10H21NO4Si and a molecular weight of 247.37 g/mol. Its IUPAC name is (2S)-2-(2-trimethylsilylethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-2-(2-trimethylsilylethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 156620019 |
| Molecular Formula | C10H21NO4Si |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (2S)-2-(2-trimethylsilylethoxycarbonylamino)butanoic acid |
| SMILES | CC[C@H](NC(=O)OCC[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H21NO4Si/c1-5-8(9(12)13)11-10(14)15-6-7-16(2,3)4/h8H,5-7H2,1-4H3,(H,11,14)(H,12,13)/t8-/m0/s1 |
| InChIKey | LUQXCJFQXDBKGE-QMMMGPOBSA-N |
| XLogP | 1.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|