C7H13NO5 — CID 88909691
(2R)-3-hydroxy-2-(propoxycarbonylamino)propanoic acid (PubChem CID 88909691) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-(propoxycarbonylamino)propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-(propoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 88909691 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | (2R)-3-hydroxy-2-(propoxycarbonylamino)propanoic acid |
| SMILES | CCCOC(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C7H13NO5/c1-2-3-13-7(12)8-5(4-9)6(10)11/h5,9H,2-4H2,1H3,(H,8,12)(H,10,11)/t5-/m1/s1 |
| InChIKey | STYYXHXQMICGLA-RXMQYKEDSA-N |
| XLogP | -0.43 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |