C11H18FNO7 — CID 118383865
acetyl fluoride;(2S)-2-(butoxycarbonylamino)butanedioic acid (PubChem CID 118383865) has the molecular formula C11H18FNO7 and a molecular weight of 295.26 g/mol. Its IUPAC name is acetyl fluoride;(2S)-2-(butoxycarbonylamino)butanedioic acid.
| Compound Name | acetyl fluoride;(2S)-2-(butoxycarbonylamino)butanedioic acid |
|---|---|
| PubChem CID | 118383865 |
| Molecular Formula | C11H18FNO7 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | acetyl fluoride;(2S)-2-(butoxycarbonylamino)butanedioic acid |
| SMILES | CC(=O)F.CCCCOC(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H15NO6.C2H3FO/c1-2-3-4-16-9(15)10-6(8(13)14)5-7(11)12;1-2(3)4/h6H,2-5H2,1H3,(H,10,15)(H,11,12)(H,13,14);1H3/t6-;/m0./s1 |
| InChIKey | TYVMRTJADZMWJM-RGMNGODLSA-N |
| XLogP | 0.94 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|