C11H19NO8Si — CID 123214933
2-(2-trimethylsilylethoxycarbonylamino)ethane-1,1,1-tricarboxylic acid (PubChem CID 123214933) has the molecular formula C11H19NO8Si and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-(2-trimethylsilylethoxycarbonylamino)ethane-1,1,1-tricarboxylic acid.
| Compound Name | 2-(2-trimethylsilylethoxycarbonylamino)ethane-1,1,1-tricarboxylic acid |
|---|---|
| PubChem CID | 123214933 |
| Molecular Formula | C11H19NO8Si |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-(2-trimethylsilylethoxycarbonylamino)ethane-1,1,1-tricarboxylic acid |
| SMILES | C[Si](C)(C)CCOC(=O)NCC(C(=O)O)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19NO8Si/c1-21(2,3)5-4-20-10(19)12-6-11(7(13)14,8(15)16)9(17)18/h4-6H2,1-3H3,(H,12,19)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | AAYBTQNRNFWYJU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|