C15H24N2O3Si — CID 174027277
2-trimethylsilylethyl N-(3-amino-3-oxo-2-phenylpropyl)carbamate (PubChem CID 174027277) has the molecular formula C15H24N2O3Si and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-(3-amino-3-oxo-2-phenylpropyl)carbamate.
| Compound Name | 2-trimethylsilylethyl N-(3-amino-3-oxo-2-phenylpropyl)carbamate |
|---|---|
| PubChem CID | 174027277 |
| Molecular Formula | C15H24N2O3Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-trimethylsilylethyl N-(3-amino-3-oxo-2-phenylpropyl)carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)NCC(C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O3Si/c1-21(2,3)10-9-20-15(19)17-11-13(14(16)18)12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H2,16,18)(H,17,19) |
| InChIKey | MOQFIKSLIDENRB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|