C18H25NO3Si — CID 15421860
2-trimethylsilylethyl N-[(1S)-2-hydroxy-1-naphthalen-2-ylethyl]carbamate (PubChem CID 15421860) has the molecular formula C18H25NO3Si and a molecular weight of 331.49 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(1S)-2-hydroxy-1-naphthalen-2-ylethyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[(1S)-2-hydroxy-1-naphthalen-2-ylethyl]carbamate |
|---|---|
| PubChem CID | 15421860 |
| Molecular Formula | C18H25NO3Si |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-trimethylsilylethyl N-[(1S)-2-hydroxy-1-naphthalen-2-ylethyl]carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)N[C@H](CO)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H25NO3Si/c1-23(2,3)11-10-22-18(21)19-17(13-20)16-9-8-14-6-4-5-7-15(14)12-16/h4-9,12,17,20H,10-11,13H2,1-3H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | GNIDCXBWSDDUIC-QGZVFWFLSA-N |
| XLogP | 3.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|