C11H15NO4 — CID 107863811
2-hydroxyethyl N-[(1R)-2-hydroxy-1-phenylethyl]carbamate (PubChem CID 107863811) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-hydroxyethyl N-[(1R)-2-hydroxy-1-phenylethyl]carbamate.
| Compound Name | 2-hydroxyethyl N-[(1R)-2-hydroxy-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 107863811 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-hydroxyethyl N-[(1R)-2-hydroxy-1-phenylethyl]carbamate |
| SMILES | O=C(N[C@@H](CO)c1ccccc1)OCCO |
| InChI | InChI=1S/C11H15NO4/c13-6-7-16-11(15)12-10(8-14)9-4-2-1-3-5-9/h1-5,10,13-14H,6-8H2,(H,12,15)/t10-/m0/s1 |
| InChIKey | JTVXQJMLHROCOL-JTQLQIEISA-N |
| XLogP | 0.44 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |