C21H26N2O4 — CID 101336347
benzyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 101336347) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 101336347 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | benzyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O4/c1-15(2)19(23-21(26)27-14-16-9-5-3-6-10-16)20(25)22-18(13-24)17-11-7-4-8-12-17/h3-12,15,18-19,24H,13-14H2,1-2H3,(H,22,25)(H,23,26)/t18-,19-/m0/s1 |
| InChIKey | KUTGJRPNMAZSGN-OALUTQOASA-N |
| XLogP | 2.79 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |