C16H22N3O4Y+2 — CID 18725857
2-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoylazanide;yttrium(3+) (PubChem CID 18725857) has the molecular formula C16H22N3O4Y+2 and a molecular weight of 409.28 g/mol. Its IUPAC name is 2-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoylazanide;yttrium(3+).
| Compound Name | 2-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoylazanide;yttrium(3+) |
|---|---|
| PubChem CID | 18725857 |
| Molecular Formula | C16H22N3O4Y+2 |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoylazanide;yttrium(3+) |
| SMILES | CC(NC(=O)C(NC(=O)OCc1ccccc1)C(C)C)C([NH-])=O.[Y+3] |
| InChI | InChI=1S/C16H23N3O4.Y/c1-10(2)13(15(21)18-11(3)14(17)20)19-16(22)23-9-12-7-5-4-6-8-12;/h4-8,10-11,13H,9H2,1-3H3,(H4,17,18,19,20,21,22);/q;+3/p-1 |
| InChIKey | ANDHIALACPKZHM-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |