C17H24N2O4 — CID 101336346
prop-2-enyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 101336346) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is prop-2-enyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | prop-2-enyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 101336346 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | prop-2-enyl N-[(2S)-1-[[(1R)-2-hydroxy-1-phenylethyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@H](C(=O)N[C@@H](CO)c1ccccc1)C(C)C |
| InChI | InChI=1S/C17H24N2O4/c1-4-10-23-17(22)19-15(12(2)3)16(21)18-14(11-20)13-8-6-5-7-9-13/h4-9,12,14-15,20H,1,10-11H2,2-3H3,(H,18,21)(H,19,22)/t14-,15-/m0/s1 |
| InChIKey | WINMNVWZUYYODG-GJZGRUSLSA-N |
| XLogP | 1.77 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|