C17H17NO4 — CID 167739374
(3S)-3-naphthalen-2-yl-3-(prop-2-enoxycarbonylamino)propanoic acid (PubChem CID 167739374) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (3S)-3-naphthalen-2-yl-3-(prop-2-enoxycarbonylamino)propanoic acid.
| Compound Name | (3S)-3-naphthalen-2-yl-3-(prop-2-enoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 167739374 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (3S)-3-naphthalen-2-yl-3-(prop-2-enoxycarbonylamino)propanoic acid |
| SMILES | C=CCOC(=O)N[C@@H](CC(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H17NO4/c1-2-9-22-17(21)18-15(11-16(19)20)14-8-7-12-5-3-4-6-13(12)10-14/h2-8,10,15H,1,9,11H2,(H,18,21)(H,19,20)/t15-/m0/s1 |
| InChIKey | FOLBSLYZFPOEHB-HNNXBMFYSA-N |
| XLogP | 3.27 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|