C15H17NO3 — CID 15364975
ethyl N-[(1R)-2-hydroxy-1-naphthalen-2-ylethyl]carbamate (PubChem CID 15364975) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is ethyl N-[(1R)-2-hydroxy-1-naphthalen-2-ylethyl]carbamate.
| Compound Name | ethyl N-[(1R)-2-hydroxy-1-naphthalen-2-ylethyl]carbamate |
|---|---|
| PubChem CID | 15364975 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | ethyl N-[(1R)-2-hydroxy-1-naphthalen-2-ylethyl]carbamate |
| SMILES | CCOC(=O)N[C@@H](CO)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H17NO3/c1-2-19-15(18)16-14(10-17)13-8-7-11-5-3-4-6-12(11)9-13/h3-9,14,17H,2,10H2,1H3,(H,16,18)/t14-/m0/s1 |
| InChIKey | OLTFBBTZKNSHDR-AWEZNQCLSA-N |
| XLogP | 2.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |