C19H26NO6P — CID 23420188
ethyl N-[(1R,2R)-2-diethoxyphosphoryl-2-hydroxy-1-naphthalen-2-ylethyl]carbamate (PubChem CID 23420188) has the molecular formula C19H26NO6P and a molecular weight of 395.39 g/mol. Its IUPAC name is ethyl N-[(1R,2R)-2-diethoxyphosphoryl-2-hydroxy-1-naphthalen-2-ylethyl]carbamate.
| Compound Name | ethyl N-[(1R,2R)-2-diethoxyphosphoryl-2-hydroxy-1-naphthalen-2-ylethyl]carbamate |
|---|---|
| PubChem CID | 23420188 |
| Molecular Formula | C19H26NO6P |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl N-[(1R,2R)-2-diethoxyphosphoryl-2-hydroxy-1-naphthalen-2-ylethyl]carbamate |
| SMILES | CCOC(=O)N[C@H](c1ccc2ccccc2c1)[C@H](O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C19H26NO6P/c1-4-24-19(22)20-17(18(21)27(23,25-5-2)26-6-3)16-12-11-14-9-7-8-10-15(14)13-16/h7-13,17-18,21H,4-6H2,1-3H3,(H,20,22)/t17-,18-/m1/s1 |
| InChIKey | MXFCVKGQLGRWDE-QZTJIDSGSA-N |
| XLogP | 4.21 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|