C30H39O6PS — CID 10578753
ethyl 2-diethoxyphosphoryl-3-(2-hydroxy-2-naphthalen-2-yl-1-phenylethyl)sulfanyl-4-methylpentanoate (PubChem CID 10578753) has the molecular formula C30H39O6PS and a molecular weight of 558.68 g/mol. Its IUPAC name is ethyl 2-diethoxyphosphoryl-3-(2-hydroxy-2-naphthalen-2-yl-1-phenylethyl)sulfanyl-4-methylpentanoate.
| Compound Name | ethyl 2-diethoxyphosphoryl-3-(2-hydroxy-2-naphthalen-2-yl-1-phenylethyl)sulfanyl-4-methylpentanoate |
|---|---|
| PubChem CID | 10578753 |
| Molecular Formula | C30H39O6PS |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | ethyl 2-diethoxyphosphoryl-3-(2-hydroxy-2-naphthalen-2-yl-1-phenylethyl)sulfanyl-4-methylpentanoate |
| SMILES | CCOC(=O)C(C(SC(c1ccccc1)C(O)c1ccc2ccccc2c1)C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C30H39O6PS/c1-6-34-30(32)27(37(33,35-7-2)36-8-3)28(21(4)5)38-29(23-15-10-9-11-16-23)26(31)25-19-18-22-14-12-13-17-24(22)20-25/h9-21,26-29,31H,6-8H2,1-5H3 |
| InChIKey | PJIXEMTXEWOJAJ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|