C29H34NO8P — CID 11813671
diethyl 2-(1-benzamidonaphthalen-2-yl)-3-diethoxyphosphorylbutanedioate (PubChem CID 11813671) has the molecular formula C29H34NO8P and a molecular weight of 555.56 g/mol. Its IUPAC name is diethyl 2-(1-benzamidonaphthalen-2-yl)-3-diethoxyphosphorylbutanedioate.
| Compound Name | diethyl 2-(1-benzamidonaphthalen-2-yl)-3-diethoxyphosphorylbutanedioate |
|---|---|
| PubChem CID | 11813671 |
| Molecular Formula | C29H34NO8P |
| Molecular Weight | 555.56 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | diethyl 2-(1-benzamidonaphthalen-2-yl)-3-diethoxyphosphorylbutanedioate |
| SMILES | CCOC(=O)C(c1ccc2ccccc2c1NC(=O)c1ccccc1)C(C(=O)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C29H34NO8P/c1-5-35-28(32)24(26(29(33)36-6-2)39(34,37-7-3)38-8-4)23-19-18-20-14-12-13-17-22(20)25(23)30-27(31)21-15-10-9-11-16-21/h9-19,24,26H,5-8H2,1-4H3,(H,30,31) |
| InChIKey | CJDRTEWXGYPDLJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.56 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|