C13H18NO5P — CID 40537671
N-[(1S)-1-diethoxyphosphoryl-2-oxoethyl]benzamide (PubChem CID 40537671) has the molecular formula C13H18NO5P and a molecular weight of 299.26 g/mol. Its IUPAC name is N-[(1S)-1-diethoxyphosphoryl-2-oxoethyl]benzamide.
| Compound Name | N-[(1S)-1-diethoxyphosphoryl-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 40537671 |
| Molecular Formula | C13H18NO5P |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-[(1S)-1-diethoxyphosphoryl-2-oxoethyl]benzamide |
| SMILES | CCOP(=O)(OCC)[C@@H](C=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18NO5P/c1-3-18-20(17,19-4-2)12(10-15)14-13(16)11-8-6-5-7-9-11/h5-10,12H,3-4H2,1-2H3,(H,14,16)/t12-/m0/s1 |
| InChIKey | OVKUFTYFSQGRKJ-LBPRGKRZSA-N |
| XLogP | 2.21 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|