C16H22NO5P — CID 14790029
N-(1-diethoxyphosphoryl-3-oxopent-4-enyl)benzamide (PubChem CID 14790029) has the molecular formula C16H22NO5P and a molecular weight of 339.33 g/mol. Its IUPAC name is N-(1-diethoxyphosphoryl-3-oxopent-4-enyl)benzamide.
| Compound Name | N-(1-diethoxyphosphoryl-3-oxopent-4-enyl)benzamide |
|---|---|
| PubChem CID | 14790029 |
| Molecular Formula | C16H22NO5P |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-(1-diethoxyphosphoryl-3-oxopent-4-enyl)benzamide |
| SMILES | C=CC(=O)CC(NC(=O)c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H22NO5P/c1-4-14(18)12-15(23(20,21-5-2)22-6-3)17-16(19)13-10-8-7-9-11-13/h4,7-11,15H,1,5-6,12H2,2-3H3,(H,17,19) |
| InChIKey | LTPOTDSLDPBYAG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|