C19H34N2O7P2 — CID 135009826
N'-[1,3-bis(diethoxyphosphoryl)butyl]benzohydrazide (PubChem CID 135009826) has the molecular formula C19H34N2O7P2 and a molecular weight of 464.44 g/mol. Its IUPAC name is N'-[1,3-bis(diethoxyphosphoryl)butyl]benzohydrazide.
| Compound Name | N'-[1,3-bis(diethoxyphosphoryl)butyl]benzohydrazide |
|---|---|
| PubChem CID | 135009826 |
| Molecular Formula | C19H34N2O7P2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N'-[1,3-bis(diethoxyphosphoryl)butyl]benzohydrazide |
| SMILES | CCOP(=O)(OCC)C(C)CC(NNC(=O)c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C19H34N2O7P2/c1-6-25-29(23,26-7-2)16(5)15-18(30(24,27-8-3)28-9-4)20-21-19(22)17-13-11-10-12-14-17/h10-14,16,18,20H,6-9,15H2,1-5H3,(H,21,22) |
| InChIKey | NNLNLPCBHGPGRU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|