C11H16NO3PS — CID 131847254
N-diethoxyphosphinothioylbenzamide (PubChem CID 131847254) has the molecular formula C11H16NO3PS and a molecular weight of 273.29 g/mol. Its IUPAC name is N-diethoxyphosphinothioylbenzamide.
| Compound Name | N-diethoxyphosphinothioylbenzamide |
|---|---|
| PubChem CID | 131847254 |
| Molecular Formula | C11H16NO3PS |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-diethoxyphosphinothioylbenzamide |
| SMILES | CCOP(=S)(NC(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C11H16NO3PS/c1-3-14-16(17,15-4-2)12-11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3,(H,12,13,17) |
| InChIKey | AVCSDEKHUULEOV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|