C16H22NO5P — CID 68912357
ethyl (Z)-2-benzamido-4-[ethoxy(methyl)phosphoryl]but-2-enoate (PubChem CID 68912357) has the molecular formula C16H22NO5P and a molecular weight of 339.33 g/mol. Its IUPAC name is ethyl (Z)-2-benzamido-4-[ethoxy(methyl)phosphoryl]but-2-enoate.
| Compound Name | ethyl (Z)-2-benzamido-4-[ethoxy(methyl)phosphoryl]but-2-enoate |
|---|---|
| PubChem CID | 68912357 |
| Molecular Formula | C16H22NO5P |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | ethyl (Z)-2-benzamido-4-[ethoxy(methyl)phosphoryl]but-2-enoate |
| SMILES | CCOC(=O)/C(=C/CP(C)(=O)OCC)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22NO5P/c1-4-21-16(19)14(11-12-23(3,20)22-5-2)17-15(18)13-9-7-6-8-10-13/h6-11H,4-5,12H2,1-3H3,(H,17,18)/b14-11- |
| InChIKey | ZGAAATCHJRRJAG-KAMYIIQDSA-N |
| XLogP | 2.81 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|