C15H20NO5P — CID 68913158
ethyl (Z)-2-benzamido-4-[methoxy(methyl)phosphoryl]but-2-enoate (PubChem CID 68913158) has the molecular formula C15H20NO5P and a molecular weight of 325.30 g/mol. Its IUPAC name is ethyl (Z)-2-benzamido-4-[methoxy(methyl)phosphoryl]but-2-enoate.
| Compound Name | ethyl (Z)-2-benzamido-4-[methoxy(methyl)phosphoryl]but-2-enoate |
|---|---|
| PubChem CID | 68913158 |
| Molecular Formula | C15H20NO5P |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | ethyl (Z)-2-benzamido-4-[methoxy(methyl)phosphoryl]but-2-enoate |
| SMILES | CCOC(=O)/C(=C/CP(C)(=O)OC)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20NO5P/c1-4-21-15(18)13(10-11-22(3,19)20-2)16-14(17)12-8-6-5-7-9-12/h5-10H,4,11H2,1-3H3,(H,16,17)/b13-10- |
| InChIKey | SQJRPHNBUSXJNN-RAXLEYEMSA-N |
| XLogP | 2.42 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|