C9H16NO5P — CID 87621088
(Z)-4-[methoxy(methyl)phosphoryl]-2-(propanoylamino)but-2-enoic acid (PubChem CID 87621088) has the molecular formula C9H16NO5P and a molecular weight of 249.20 g/mol. Its IUPAC name is (Z)-4-[methoxy(methyl)phosphoryl]-2-(propanoylamino)but-2-enoic acid.
| Compound Name | (Z)-4-[methoxy(methyl)phosphoryl]-2-(propanoylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 87621088 |
| Molecular Formula | C9H16NO5P |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (Z)-4-[methoxy(methyl)phosphoryl]-2-(propanoylamino)but-2-enoic acid |
| SMILES | CCC(=O)N/C(=C\CP(C)(=O)OC)C(=O)O |
| InChI | InChI=1S/C9H16NO5P/c1-4-8(11)10-7(9(12)13)5-6-16(3,14)15-2/h5H,4,6H2,1-3H3,(H,10,11)(H,12,13)/b7-5- |
| InChIKey | GPXNQNYXAADPBT-ALCCZGGFSA-N |
| XLogP | 1.04 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|