C8H14NO6P — CID 89147423
(Z)-2-(ethoxycarbonylamino)-4-[hydroxy(methyl)phosphoryl]but-2-enoic acid (PubChem CID 89147423) has the molecular formula C8H14NO6P and a molecular weight of 251.17 g/mol. Its IUPAC name is (Z)-2-(ethoxycarbonylamino)-4-[hydroxy(methyl)phosphoryl]but-2-enoic acid.
| Compound Name | (Z)-2-(ethoxycarbonylamino)-4-[hydroxy(methyl)phosphoryl]but-2-enoic acid |
|---|---|
| PubChem CID | 89147423 |
| Molecular Formula | C8H14NO6P |
| Molecular Weight | 251.17 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | (Z)-2-(ethoxycarbonylamino)-4-[hydroxy(methyl)phosphoryl]but-2-enoic acid |
| SMILES | CCOC(=O)N/C(=C\CP(C)(=O)O)C(=O)O |
| InChI | InChI=1S/C8H14NO6P/c1-3-15-8(12)9-6(7(10)11)4-5-16(2,13)14/h4H,3,5H2,1-2H3,(H,9,12)(H,10,11)(H,13,14)/b6-4- |
| InChIKey | HVKJMOWNBFHQOZ-XQRVVYSFSA-N |
| XLogP | 0.60 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.17 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|