C18H20NO3P — CID 12904300
ethyl (E)-2-(diphenylphosphorylamino)but-2-enoate (PubChem CID 12904300) has the molecular formula C18H20NO3P and a molecular weight of 329.34 g/mol. Its IUPAC name is ethyl (E)-2-(diphenylphosphorylamino)but-2-enoate.
| Compound Name | ethyl (E)-2-(diphenylphosphorylamino)but-2-enoate |
|---|---|
| PubChem CID | 12904300 |
| Molecular Formula | C18H20NO3P |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | ethyl (E)-2-(diphenylphosphorylamino)but-2-enoate |
| SMILES | C/C=C(/NP(=O)(c1ccccc1)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C18H20NO3P/c1-3-17(18(20)22-4-2)19-23(21,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h3,5-14H,4H2,1-2H3,(H,19,21)/b17-3+ |
| InChIKey | XAIRSZYPNXECCE-IJUHEHPCSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|