About ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate
ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate (PubChem CID 11471690) has the molecular formula C17H19O2P
and a molecular weight of 286.31 g/mol. Its IUPAC name is ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate.
Molecular Properties
| Compound Name | ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate |
| PubChem CID | 11471690 |
| Molecular Formula | C17H19O2P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate |
| SMILES | CCOC(=O)C=P(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19O2P/c1-3-19-17(18)14-20(2,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14H,3H2,1-2H3 |
| InChIKey | HYVCUSOHYJKXGS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate?
The IUPAC name of ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate (CID 11471690) is ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate.
What is the SMILES notation for ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate?
The canonical SMILES for ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate is CCOC(=O)C=P(C)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate?
The InChIKey is HYVCUSOHYJKXGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19O2P/c1-3-19-17(18)14-20(2,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-14H,3H2,1-2H3.
What are the key properties of ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate?
ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate has a molecular weight of 286.31 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[methyl(diphenyl)-λ5-phosphanylidene]acetate is sourced from PubChem (CID 11471690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).