C40H49O8P — CID 159094990
diethyl (2E,7E)-nona-2,7-dienedioate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;pentanedial (PubChem CID 159094990) has the molecular formula C40H49O8P and a molecular weight of 688.80 g/mol. Its IUPAC name is diethyl (2E,7E)-nona-2,7-dienedioate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;pentanedial.
| Compound Name | diethyl (2E,7E)-nona-2,7-dienedioate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;pentanedial |
|---|---|
| PubChem CID | 159094990 |
| Molecular Formula | C40H49O8P |
| Molecular Weight | 688.80 g/mol |
| Exact Mass | 688.32 |
| IUPAC Name | diethyl (2E,7E)-nona-2,7-dienedioate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;pentanedial |
| SMILES | CCOC(=O)/C=C/CCC/C=C/C(=O)OCC.CCOC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.O=CCCCC=O |
| InChI | InChI=1S/C22H21O2P.C13H20O4.C5H8O2/c1-2-24-22(23)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-3-16-12(14)10-8-6-5-7-9-11-13(15)17-4-2;6-4-2-1-3-5-7/h3-18H,2H2,1H3;8-11H,3-7H2,1-2H3;4-5H,1-3H2/b;10-8+,11-9+; |
| InChIKey | KCOALHGXBGZCCR-MTIOYHFMSA-N |
| XLogP | 6.30 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.80 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|