C36H43O9P — CID 158101747
dimethyl (E)-hept-2-enedioate;methyl 5-oxopentanoate;methyl 2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 158101747) has the molecular formula C36H43O9P and a molecular weight of 650.70 g/mol. Its IUPAC name is dimethyl (E)-hept-2-enedioate;methyl 5-oxopentanoate;methyl 2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | dimethyl (E)-hept-2-enedioate;methyl 5-oxopentanoate;methyl 2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 158101747 |
| Molecular Formula | C36H43O9P |
| Molecular Weight | 650.70 g/mol |
| Exact Mass | 650.26 |
| IUPAC Name | dimethyl (E)-hept-2-enedioate;methyl 5-oxopentanoate;methyl 2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | COC(=O)/C=C/CCCC(=O)OC.COC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.COC(=O)CCCC=O |
| InChI | InChI=1S/C21H19O2P.C9H14O4.C6H10O3/c1-23-21(22)17-24(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20;1-12-8(10)6-4-3-5-7-9(11)13-2;1-9-6(8)4-2-3-5-7/h2-17H,1H3;4,6H,3,5,7H2,1-2H3;5H,2-4H2,1H3/b;6-4+; |
| InChIKey | FPIRDLGUZFWFPO-HWWUXOKASA-N |
| XLogP | 4.54 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.70 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|