C25H25O4P — CID 129011469
methyl (3S)-3-hydroxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate (PubChem CID 129011469) has the molecular formula C25H25O4P and a molecular weight of 420.45 g/mol. Its IUPAC name is methyl (3S)-3-hydroxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate.
| Compound Name | methyl (3S)-3-hydroxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate |
|---|---|
| PubChem CID | 129011469 |
| Molecular Formula | C25H25O4P |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | methyl (3S)-3-hydroxy-5-oxo-6-(triphenyl-λ5-phosphanylidene)hexanoate |
| SMILES | COC(=O)C[C@@H](O)CC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25O4P/c1-29-25(28)18-20(26)17-21(27)19-30(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-16,19-20,26H,17-18H2,1H3/t20-/m0/s1 |
| InChIKey | HIJZDQRODNGUPL-FQEVSTJZSA-N |
| XLogP | 2.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|