About methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide
methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide (PubChem CID 146120929) has the molecular formula C24H24BrO3P
and a molecular weight of 471.33 g/mol. Its IUPAC name is methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide.
Molecular Properties
| Compound Name | methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide |
| PubChem CID | 146120929 |
| Molecular Formula | C24H24BrO3P |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide |
| SMILES | Br.COC(=O)CCC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23O3P.BrH/c1-27-24(26)18-17-20(25)19-28(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23;/h2-16,19H,17-18H2,1H3;1H |
| InChIKey | QAFGNOAZLRNQBN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide?
The IUPAC name of methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide (CID 146120929) is methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide.
What is the SMILES notation for methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide?
The canonical SMILES for methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide is Br.COC(=O)CCC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide?
The InChIKey is QAFGNOAZLRNQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23O3P.BrH/c1-27-24(26)18-17-20(25)19-28(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23;/h2-16,19H,17-18H2,1H3;1H.
What are the key properties of methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide?
methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide has a molecular weight of 471.33 g/mol, XLogP of 3.88, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-5-(triphenyl-λ5-phosphanylidene)pentanoate;hydrobromide is sourced from PubChem (CID 146120929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).