C33H39O2P — CID 71328578
14-oxo-15-(triphenyl-λ5-phosphanylidene)pentadec-9-enal (PubChem CID 71328578) has the molecular formula C33H39O2P and a molecular weight of 498.65 g/mol. Its IUPAC name is 14-oxo-15-(triphenyl-λ5-phosphanylidene)pentadec-9-enal.
| Compound Name | 14-oxo-15-(triphenyl-λ5-phosphanylidene)pentadec-9-enal |
|---|---|
| PubChem CID | 71328578 |
| Molecular Formula | C33H39O2P |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 14-oxo-15-(triphenyl-λ5-phosphanylidene)pentadec-9-enal |
| SMILES | O=CCCCCCCCC=CCCCC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H39O2P/c34-28-20-9-7-5-3-1-2-4-6-8-13-21-30(35)29-36(31-22-14-10-15-23-31,32-24-16-11-17-25-32)33-26-18-12-19-27-33/h4,6,10-12,14-19,22-29H,1-3,5,7-9,13,20-21H2 |
| InChIKey | XAKCWMJCXFBKJN-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|