About potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate
potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate (PubChem CID 23669925) has the molecular formula C23H22KO2P
and a molecular weight of 400.50 g/mol. Its IUPAC name is potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate.
Molecular Properties
| Compound Name | potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate |
| PubChem CID | 23669925 |
| Molecular Formula | C23H22KO2P |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate |
| SMILES | O=C([O-])CCCC=P(c1ccccc1)(c1ccccc1)c1ccccc1.[K+] |
| InChI | InChI=1S/C23H23O2P.K/c24-23(25)18-10-11-19-26(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22;/h1-9,12-17,19H,10-11,18H2,(H,24,25);/q;+1/p-1 |
| InChIKey | PRIKAOVBQVYXOQ-UHFFFAOYSA-M |
| XLogP | -0.29 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate?
The IUPAC name of potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate (CID 23669925) is potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate.
What is the SMILES notation for potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate?
The canonical SMILES for potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate is O=C([O-])CCCC=P(c1ccccc1)(c1ccccc1)c1ccccc1.[K+].
What is the InChIKey of potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate?
The InChIKey is PRIKAOVBQVYXOQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H23O2P.K/c24-23(25)18-10-11-19-26(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22;/h1-9,12-17,19H,10-11,18H2,(H,24,25);/q;+1/p-1.
What are the key properties of potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate?
potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate has a molecular weight of 400.50 g/mol, XLogP of -0.29, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-(triphenyl-λ5-phosphanylidene)pentanoate is sourced from PubChem (CID 23669925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).