About lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate
lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate (PubChem CID 23673071) has the molecular formula C22H22LiOP
and a molecular weight of 340.33 g/mol. Its IUPAC name is lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate.
Molecular Properties
| Compound Name | lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate |
| PubChem CID | 23673071 |
| Molecular Formula | C22H22LiOP |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate |
| SMILES | [Li+].[O-]CCCC=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22OP.Li/c23-18-10-11-19-24(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22;/h1-9,12-17,19H,10-11,18H2;/q-1;+1 |
| InChIKey | WFFJJXAZUZDIMA-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate?
The IUPAC name of lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate (CID 23673071) is lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate.
What is the SMILES notation for lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate?
The canonical SMILES for lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate is [Li+].[O-]CCCC=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate?
The InChIKey is WFFJJXAZUZDIMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22OP.Li/c23-18-10-11-19-24(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22;/h1-9,12-17,19H,10-11,18H2;/q-1;+1.
What are the key properties of lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate?
lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate has a molecular weight of 340.33 g/mol, XLogP of -0.07, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 4-(triphenyl-λ5-phosphanylidene)butan-1-olate is sourced from PubChem (CID 23673071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).