C24H25O2P — CID 11349379
6-hydroxy-1-(triphenyl-λ5-phosphanylidene)hexan-2-one (PubChem CID 11349379) has the molecular formula C24H25O2P and a molecular weight of 376.44 g/mol. Its IUPAC name is 6-hydroxy-1-(triphenyl-λ5-phosphanylidene)hexan-2-one.
| Compound Name | 6-hydroxy-1-(triphenyl-λ5-phosphanylidene)hexan-2-one |
|---|---|
| PubChem CID | 11349379 |
| Molecular Formula | C24H25O2P |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 6-hydroxy-1-(triphenyl-λ5-phosphanylidene)hexan-2-one |
| SMILES | O=C(C=P(c1ccccc1)(c1ccccc1)c1ccccc1)CCCCO |
| InChI | InChI=1S/C24H25O2P/c25-19-11-10-12-21(26)20-27(22-13-4-1-5-14-22,23-15-6-2-7-16-23)24-17-8-3-9-18-24/h1-9,13-18,20,25H,10-12,19H2 |
| InChIKey | VAWSUDUNYNHPBJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|