About [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate
[(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 102278127) has the molecular formula C24H23O2P
and a molecular weight of 374.42 g/mol. Its IUPAC name is [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate.
Molecular Properties
| Compound Name | [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate |
| PubChem CID | 102278127 |
| Molecular Formula | C24H23O2P |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | C/C=C/COC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23O2P/c1-2-3-19-26-24(25)20-27(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h2-18,20H,19H2,1H3/b3-2+ |
| InChIKey | OODSPGDDTYBVGO-NSCUHMNNSA-N |
| XLogP | 3.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate?
The IUPAC name of [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate (CID 102278127) is [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate.
What is the SMILES notation for [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate?
The canonical SMILES for [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate is C/C=C/COC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate?
The InChIKey is OODSPGDDTYBVGO-NSCUHMNNSA-N. The full InChI is InChI=1S/C24H23O2P/c1-2-3-19-26-24(25)20-27(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h2-18,20H,19H2,1H3/b3-2+.
What are the key properties of [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate?
[(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate has a molecular weight of 374.42 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enyl] 2-(triphenyl-λ5-phosphanylidene)acetate is sourced from PubChem (CID 102278127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).