About ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide
ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide (PubChem CID 173228193) has the molecular formula C22H22BrO2P
and a molecular weight of 429.29 g/mol. Its IUPAC name is ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide.
Molecular Properties
| Compound Name | ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide |
| PubChem CID | 173228193 |
| Molecular Formula | C22H22BrO2P |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide |
| SMILES | Br.CCOC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21O2P.BrH/c1-2-24-22(23)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;/h3-18H,2H2,1H3;1H |
| InChIKey | SRQAJNVYEODBIC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide?
The IUPAC name of ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide (CID 173228193) is ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide.
What is the SMILES notation for ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide?
The canonical SMILES for ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide is Br.CCOC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide?
The InChIKey is SRQAJNVYEODBIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21O2P.BrH/c1-2-24-22(23)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;/h3-18H,2H2,1H3;1H.
What are the key properties of ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide?
ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide has a molecular weight of 429.29 g/mol, XLogP of 3.92, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(triphenyl-λ5-phosphanylidene)acetate;hydrobromide is sourced from PubChem (CID 173228193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).