C35H40NO6PS — CID 161013590
3-O-ethyl 4-O-methyl 2-methyl-5-(propan-2-ylamino)thiophene-3,4-dicarboxylate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 161013590) has the molecular formula C35H40NO6PS and a molecular weight of 633.75 g/mol. Its IUPAC name is 3-O-ethyl 4-O-methyl 2-methyl-5-(propan-2-ylamino)thiophene-3,4-dicarboxylate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | 3-O-ethyl 4-O-methyl 2-methyl-5-(propan-2-ylamino)thiophene-3,4-dicarboxylate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 161013590 |
| Molecular Formula | C35H40NO6PS |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.23 |
| IUPAC Name | 3-O-ethyl 4-O-methyl 2-methyl-5-(propan-2-ylamino)thiophene-3,4-dicarboxylate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | CCOC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.CCOC(=O)c1c(C)sc(NC(C)C)c1C(=O)OC |
| InChI | InChI=1S/C22H21O2P.C13H19NO4S/c1-2-24-22(23)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-6-18-13(16)9-8(4)19-11(14-7(2)3)10(9)12(15)17-5/h3-18H,2H2,1H3;7,14H,6H2,1-5H3 |
| InChIKey | TXKWMGAPYDDMCU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|