C28H31O5P — CID 162263800
dideuteriomethanone;ethyl 3,3-dideuterioprop-2-enoate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 162263800) has the molecular formula C28H31O5P and a molecular weight of 482.55 g/mol. Its IUPAC name is dideuteriomethanone;ethyl 3,3-dideuterioprop-2-enoate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | dideuteriomethanone;ethyl 3,3-dideuterioprop-2-enoate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 162263800 |
| Molecular Formula | C28H31O5P |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | dideuteriomethanone;ethyl 3,3-dideuterioprop-2-enoate;ethyl 2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | CCOC(=O)C=P(c1ccccc1)(c1ccccc1)c1ccccc1.[2H]C([2H])=CC(=O)OCC.[2H]C([2H])=O |
| InChI | InChI=1S/C22H21O2P.C5H8O2.CH2O/c1-2-24-22(23)18-25(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-3-5(6)7-4-2;1-2/h3-18H,2H2,1H3;3H,1,4H2,2H3;1H2/i;2*1D2 |
| InChIKey | ZZPSJZJRVYCYPK-RDONWYJMSA-N |
| XLogP | 3.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|